C22H20FN7 — CID 172786362
5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)-4-quinolin-3-ylpyrimidin-2-amine (PubChem CID 172786362) has the molecular formula C22H20FN7 and a molecular weight of 401.45 g/mol. Its IUPAC name is 5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)-4-quinolin-3-ylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)-4-quinolin-3-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 172786362 |
| Molecular Formula | C22H20FN7 |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 5-fluoro-N-(5-piperazin-1-yl-2-pyridinyl)-4-quinolin-3-ylpyrimidin-2-amine |
| SMILES | Fc1cnc(Nc2ccc(N3CCNCC3)cn2)nc1-c1cnc2ccccc2c1 |
| InChI | InChI=1S/C22H20FN7/c23-18-14-27-22(28-20-6-5-17(13-26-20)30-9-7-24-8-10-30)29-21(18)16-11-15-3-1-2-4-19(15)25-12-16/h1-6,11-14,24H,7-10H2,(H,26,27,28,29) |
| InChIKey | OYGNDNNINJVSTB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |