C24H32N8O — CID 172786800
8-N-(2,2-dimethylpropyl)-2-[4-(4-ethyl-1,2,4-triazol-3-yl)-2-methoxyphenyl]-6-methyl-1H-pyrido[3,4-d]pyrimidine-2,8-diamine (PubChem CID 172786800) has the molecular formula C24H32N8O and a molecular weight of 448.58 g/mol. Its IUPAC name is 8-N-(2,2-dimethylpropyl)-2-[4-(4-ethyl-1,2,4-triazol-3-yl)-2-methoxyphenyl]-6-methyl-1H-pyrido[3,4-d]pyrimidine-2,8-diamine.
| Compound Name | 8-N-(2,2-dimethylpropyl)-2-[4-(4-ethyl-1,2,4-triazol-3-yl)-2-methoxyphenyl]-6-methyl-1H-pyrido[3,4-d]pyrimidine-2,8-diamine |
|---|---|
| PubChem CID | 172786800 |
| Molecular Formula | C24H32N8O |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 8-N-(2,2-dimethylpropyl)-2-[4-(4-ethyl-1,2,4-triazol-3-yl)-2-methoxyphenyl]-6-methyl-1H-pyrido[3,4-d]pyrimidine-2,8-diamine |
| SMILES | CCn1cnnc1-c1ccc(C2(N)N=Cc3cc(C)nc(NCC(C)(C)C)c3N2)c(OC)c1 |
| InChI | InChI=1S/C24H32N8O/c1-7-32-14-28-31-22(32)16-8-9-18(19(11-16)33-6)24(25)27-12-17-10-15(2)29-21(20(17)30-24)26-13-23(3,4)5/h8-12,14,30H,7,13,25H2,1-6H3,(H,26,29) |
| InChIKey | OZWCZWBRWYQJCJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |