C15H12FN4OS+ — CID 172787020
4-(2-fluorophenyl)-11,12-dimethyl-11-thionia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,9-tetraen-7-one (PubChem CID 172787020) has the molecular formula C15H12FN4OS+ and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-11,12-dimethyl-11-thionia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,9-tetraen-7-one.
| Compound Name | 4-(2-fluorophenyl)-11,12-dimethyl-11-thionia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,9-tetraen-7-one |
|---|---|
| PubChem CID | 172787020 |
| Molecular Formula | C15H12FN4OS+ |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-(2-fluorophenyl)-11,12-dimethyl-11-thionia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,9-tetraen-7-one |
| SMILES | Cc1c2c(c[s+]1C)[nH]c(=O)n1nc(-c3ccccc3F)nc21 |
| InChI | InChI=1S/C15H11FN4OS/c1-8-12-11(7-22(8)2)17-15(21)20-14(12)18-13(19-20)9-5-3-4-6-10(9)16/h3-7H,1-2H3/p+1 |
| InChIKey | PARBPPNNBIFLEO-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|