About 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one
2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one (PubChem CID 172787270) has the molecular formula C26H25N3O
and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one.
Molecular Properties
| Compound Name | 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one |
| PubChem CID | 172787270 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one |
| SMILES | CN1C(C)(C)CC(=O)C1(Cc1ccccc1)c1ncc(C#Cc2ccccc2)cn1 |
| InChI | InChI=1S/C26H25N3O/c1-25(2)17-23(30)26(29(25)3,16-21-12-8-5-9-13-21)24-27-18-22(19-28-24)15-14-20-10-6-4-7-11-20/h4-13,18-19H,16-17H2,1-3H3 |
| InChIKey | PBNDWDBNFWVTNF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one?
The IUPAC name of 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one (CID 172787270) is 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one.
What is the SMILES notation for 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one?
The canonical SMILES for 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one is CN1C(C)(C)CC(=O)C1(Cc1ccccc1)c1ncc(C#Cc2ccccc2)cn1.
What is the InChIKey of 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one?
The InChIKey is PBNDWDBNFWVTNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O/c1-25(2)17-23(30)26(29(25)3,16-21-12-8-5-9-13-21)24-27-18-22(19-28-24)15-14-20-10-6-4-7-11-20/h4-13,18-19H,16-17H2,1-3H3.
What are the key properties of 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one?
2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one has a molecular weight of 395.51 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,5,5-trimethyl-2-[5-(2-phenylethynyl)pyrimidin-2-yl]pyrrolidin-3-one is sourced from PubChem (CID 172787270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).