C13H23N5O9S3 — CID 172788080
[(2S,5R)-2-[N'-(1-methylsulfonylpiperidin-3-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 172788080) has the molecular formula C13H23N5O9S3 and a molecular weight of 489.55 g/mol. Its IUPAC name is [(2S,5R)-2-[N'-(1-methylsulfonylpiperidin-3-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N'-(1-methylsulfonylpiperidin-3-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172788080 |
| Molecular Formula | C13H23N5O9S3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | [(2S,5R)-2-[N'-(1-methylsulfonylpiperidin-3-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CS(=O)(=O)N1CCCC(S(=O)(=O)N=C(N)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)C1 |
| InChI | InChI=1S/C13H23N5O9S3/c1-28(20,21)16-6-2-3-10(8-16)29(22,23)15-12(14)11-5-4-9-7-17(11)13(19)18(9)27-30(24,25)26/h9-11H,2-8H2,1H3,(H2,14,15)(H,24,25,26)/t9-,10?,11+/m1/s1 |
| InChIKey | PEGJJMNYNPPXII-FBKFWFMHSA-N |
| XLogP | -1.90 |
| TPSA | 197.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|