C8H8N6O2 — CID 172788386
2,4-dimethoxy-6-(1,3,5-triazin-2-yl)-1,3,5-triazine (PubChem CID 172788386) has the molecular formula C8H8N6O2 and a molecular weight of 220.19 g/mol. Its IUPAC name is 2,4-dimethoxy-6-(1,3,5-triazin-2-yl)-1,3,5-triazine.
| Compound Name | 2,4-dimethoxy-6-(1,3,5-triazin-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 172788386 |
| Molecular Formula | C8H8N6O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2,4-dimethoxy-6-(1,3,5-triazin-2-yl)-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(-c2ncncn2)n1 |
| InChI | InChI=1S/C8H8N6O2/c1-15-7-12-6(13-8(14-7)16-2)5-10-3-9-4-11-5/h3-4H,1-2H3 |
| InChIKey | PFKASLZZJVYGGC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |