About lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene
lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene (PubChem CID 172788476) has the molecular formula C11H17Li
and a molecular weight of 156.20 g/mol. Its IUPAC name is lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene |
| PubChem CID | 172788476 |
| Molecular Formula | C11H17Li |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene |
| SMILES | CCCc1c(C)[cH-]c(C)c1C.[Li+] |
| InChI | InChI=1S/C11H17.Li/c1-5-6-11-9(3)7-8(2)10(11)4;/h7H,5-6H2,1-4H3;/q-1;+1 |
| InChIKey | OJKPVJCXLFEOTJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene?
The IUPAC name of lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene (CID 172788476) is lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene.
What is the SMILES notation for lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene?
The canonical SMILES for lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene is CCCc1c(C)[cH-]c(C)c1C.[Li+].
What is the InChIKey of lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene?
The InChIKey is OJKPVJCXLFEOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17.Li/c1-5-6-11-9(3)7-8(2)10(11)4;/h7H,5-6H2,1-4H3;/q-1;+1.
What are the key properties of lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene?
lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene has a molecular weight of 156.20 g/mol, XLogP of 0.29, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1,2,4-trimethyl-3-propylcyclopenta-1,3-diene is sourced from PubChem (CID 172788476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).