About 1,5-dimethyl-1,5-naphthyridine
1,5-dimethyl-1,5-naphthyridine (PubChem CID 172788991) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,5-dimethyl-1,5-naphthyridine.
Molecular Properties
| Compound Name | 1,5-dimethyl-1,5-naphthyridine |
| PubChem CID | 172788991 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,5-dimethyl-1,5-naphthyridine |
| SMILES | CN1C=CC=C2C1=CC=CN2C |
| InChI | InChI=1S/C10H12N2/c1-11-7-3-6-10-9(11)5-4-8-12(10)2/h3-8H,1-2H3 |
| InChIKey | PHKGBOLTAIDBRM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethyl-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-1,5-naphthyridine?
The IUPAC name of 1,5-dimethyl-1,5-naphthyridine (CID 172788991) is 1,5-dimethyl-1,5-naphthyridine.
What is the SMILES notation for 1,5-dimethyl-1,5-naphthyridine?
The canonical SMILES for 1,5-dimethyl-1,5-naphthyridine is CN1C=CC=C2C1=CC=CN2C.
What is the InChIKey of 1,5-dimethyl-1,5-naphthyridine?
The InChIKey is PHKGBOLTAIDBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-11-7-3-6-10-9(11)5-4-8-12(10)2/h3-8H,1-2H3.
What are the key properties of 1,5-dimethyl-1,5-naphthyridine?
1,5-dimethyl-1,5-naphthyridine has a molecular weight of 160.22 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-1,5-naphthyridine is sourced from PubChem (CID 172788991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).