About 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine
2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 172789077) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine.
Analyze 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine?
The IUPAC name of 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine (CID 172789077) is 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine.
What is the SMILES notation for 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine?
The canonical SMILES for 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine is C=CC1=NC(C)C(C)CO1.
What is the InChIKey of 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine?
The InChIKey is PHRHUEBINCDGNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-4-8-9-7(3)6(2)5-10-8/h4,6-7H,1,5H2,2-3H3.
What are the key properties of 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine?
2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine has a molecular weight of 139.20 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4,5-dimethyl-5,6-dihydro-4H-1,3-oxazine is sourced from PubChem (CID 172789077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).