About 1-methylidene-2,4,5,7-tetranitrofluorene
1-methylidene-2,4,5,7-tetranitrofluorene (PubChem CID 172789120) has the molecular formula C14H6N4O8
and a molecular weight of 358.22 g/mol. Its IUPAC name is 1-methylidene-2,4,5,7-tetranitrofluorene.
Molecular Properties
| Compound Name | 1-methylidene-2,4,5,7-tetranitrofluorene |
| PubChem CID | 172789120 |
| Molecular Formula | C14H6N4O8 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-methylidene-2,4,5,7-tetranitrofluorene |
| SMILES | C=c1c([N+](=O)[O-])cc([N+](=O)[O-])c2c1=Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C14H6N4O8/c1-6-9-3-7-2-8(15(19)20)4-11(17(23)24)13(7)14(9)12(18(25)26)5-10(6)16(21)22/h2-5H,1H2 |
| InChIKey | PHVOILUUOBIOPZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methylidene-2,4,5,7-tetranitrofluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylidene-2,4,5,7-tetranitrofluorene?
The IUPAC name of 1-methylidene-2,4,5,7-tetranitrofluorene (CID 172789120) is 1-methylidene-2,4,5,7-tetranitrofluorene.
What is the SMILES notation for 1-methylidene-2,4,5,7-tetranitrofluorene?
The canonical SMILES for 1-methylidene-2,4,5,7-tetranitrofluorene is C=c1c([N+](=O)[O-])cc([N+](=O)[O-])c2c1=Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2.
What is the InChIKey of 1-methylidene-2,4,5,7-tetranitrofluorene?
The InChIKey is PHVOILUUOBIOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6N4O8/c1-6-9-3-7-2-8(15(19)20)4-11(17(23)24)13(7)14(9)12(18(25)26)5-10(6)16(21)22/h2-5H,1H2.
What are the key properties of 1-methylidene-2,4,5,7-tetranitrofluorene?
1-methylidene-2,4,5,7-tetranitrofluorene has a molecular weight of 358.22 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylidene-2,4,5,7-tetranitrofluorene is sourced from PubChem (CID 172789120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).