C18H17N5S — CID 172790149
4,5-dimethyl-1,3-thiazole;2,5-diphenyltetrazole (PubChem CID 172790149) has the molecular formula C18H17N5S and a molecular weight of 335.44 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-thiazole;2,5-diphenyltetrazole.
| Compound Name | 4,5-dimethyl-1,3-thiazole;2,5-diphenyltetrazole |
|---|---|
| PubChem CID | 172790149 |
| Molecular Formula | C18H17N5S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4,5-dimethyl-1,3-thiazole;2,5-diphenyltetrazole |
| SMILES | Cc1ncsc1C.c1ccc(-c2nnn(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C13H10N4.C5H7NS/c1-3-7-11(8-4-1)13-14-16-17(15-13)12-9-5-2-6-10-12;1-4-5(2)7-3-6-4/h1-10H;3H,1-2H3 |
| InChIKey | PLNGYBVTZNEMHE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |