About 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride
1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride (PubChem CID 172790212) has the molecular formula C17H24BrClN2
and a molecular weight of 371.75 g/mol. Its IUPAC name is 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride.
Molecular Properties
| Compound Name | 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride |
| PubChem CID | 172790212 |
| Molecular Formula | C17H24BrClN2 |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride |
| SMILES | CCCCCCC[n+]1ccc(-c2cc[nH+]cc2)cc1.[Br-].[Cl-] |
| InChI | InChI=1S/C17H23N2.BrH.ClH/c1-2-3-4-5-6-13-19-14-9-17(10-15-19)16-7-11-18-12-8-16;;/h7-12,14-15H,2-6,13H2,1H3;2*1H/q+1;;/p-1 |
| InChIKey | PLSRBUIQRBFVGJ-UHFFFAOYSA-M |
| XLogP | -2.57 |
| TPSA | 18.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride?
The IUPAC name of 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride (CID 172790212) is 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride.
What is the SMILES notation for 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride?
The canonical SMILES for 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride is CCCCCCC[n+]1ccc(-c2cc[nH+]cc2)cc1.[Br-].[Cl-].
What is the InChIKey of 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride?
The InChIKey is PLSRBUIQRBFVGJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H23N2.BrH.ClH/c1-2-3-4-5-6-13-19-14-9-17(10-15-19)16-7-11-18-12-8-16;;/h7-12,14-15H,2-6,13H2,1H3;2*1H/q+1;;/p-1.
What are the key properties of 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride?
1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride has a molecular weight of 371.75 g/mol, XLogP of -2.57, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptyl-4-pyridin-1-ium-4-ylpyridin-1-ium;bromide;chloride is sourced from PubChem (CID 172790212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).