C24H39Cl2IN+ — CID 172790333
(4,6-dichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl-diheptyl-prop-2-ynylazanium (PubChem CID 172790333) has the molecular formula C24H39Cl2IN+ and a molecular weight of 539.39 g/mol. Its IUPAC name is (4,6-dichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl-diheptyl-prop-2-ynylazanium.
| Compound Name | (4,6-dichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl-diheptyl-prop-2-ynylazanium |
|---|---|
| PubChem CID | 172790333 |
| Molecular Formula | C24H39Cl2IN+ |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (4,6-dichloro-1-iodocyclohexa-2,4-dien-1-yl)methyl-diheptyl-prop-2-ynylazanium |
| SMILES | C#CC[N+](CCCCCCC)(CCCCCCC)CC1(I)C=CC(Cl)=CC1Cl |
| InChI | InChI=1S/C24H39Cl2IN/c1-4-7-9-11-13-18-28(17-6-3,19-14-12-10-8-5-2)21-24(27)16-15-22(25)20-23(24)26/h3,15-16,20,23H,4-5,7-14,17-19,21H2,1-2H3/q+1 |
| InChIKey | SDIOPXTYKCYGHH-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|