C7H7F6N2+ — CID 172791994
1-(1,1,2,3,3,3-hexafluoropropyl)-1-methylimidazol-1-ium (PubChem CID 172791994) has the molecular formula C7H7F6N2+ and a molecular weight of 233.14 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropyl)-1-methylimidazol-1-ium.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropyl)-1-methylimidazol-1-ium |
|---|---|
| PubChem CID | 172791994 |
| Molecular Formula | C7H7F6N2+ |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropyl)-1-methylimidazol-1-ium |
| SMILES | C[N+]1(C(F)(F)C(F)C(F)(F)F)C=CN=C1 |
| InChI | InChI=1S/C7H7F6N2/c1-15(3-2-14-4-15)7(12,13)5(8)6(9,10)11/h2-5H,1H3/q+1 |
| InChIKey | IXIPDAWYUFOHDH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|