C10H12O2 — CID 172792412
(3aR)-5-hydroxy-2-methylidene-3a,4,5,6-tetrahydro-3H-inden-1-one (PubChem CID 172792412) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (3aR)-5-hydroxy-2-methylidene-3a,4,5,6-tetrahydro-3H-inden-1-one.
| Compound Name | (3aR)-5-hydroxy-2-methylidene-3a,4,5,6-tetrahydro-3H-inden-1-one |
|---|---|
| PubChem CID | 172792412 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (3aR)-5-hydroxy-2-methylidene-3a,4,5,6-tetrahydro-3H-inden-1-one |
| SMILES | C=C1C[C@@H]2CC(O)CC=C2C1=O |
| InChI | InChI=1S/C10H12O2/c1-6-4-7-5-8(11)2-3-9(7)10(6)12/h3,7-8,11H,1-2,4-5H2/t7-,8?/m1/s1 |
| InChIKey | PTCOXDZJFZRQJQ-GVHYBUMESA-N |
| XLogP | 1.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|