About oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide
oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide (PubChem CID 172792915) has the molecular formula C13H21NO4
and a molecular weight of 255.31 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide |
| PubChem CID | 172792915 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide |
| SMILES | C=C(C)C(=O)OCC1CO1.C=CC(=O)NC(C)C |
| InChI | InChI=1S/C7H10O3.C6H11NO/c1-5(2)7(8)10-4-6-3-9-6;1-4-6(8)7-5(2)3/h6H,1,3-4H2,2H3;4-5H,1H2,2-3H3,(H,7,8) |
| InChIKey | PUWLNQGEOXDXTE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide?
The IUPAC name of oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide (CID 172792915) is oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide.
What is the SMILES notation for oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide?
The canonical SMILES for oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide is C=C(C)C(=O)OCC1CO1.C=CC(=O)NC(C)C.
What is the InChIKey of oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide?
The InChIKey is PUWLNQGEOXDXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.C6H11NO/c1-5(2)7(8)10-4-6-3-9-6;1-4-6(8)7-5(2)3/h6H,1,3-4H2,2H3;4-5H,1H2,2-3H3,(H,7,8).
What are the key properties of oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide?
oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide has a molecular weight of 255.31 g/mol, XLogP of 1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 2-methylprop-2-enoate;N-propan-2-ylprop-2-enamide is sourced from PubChem (CID 172792915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).