About 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide
3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 172793905) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide |
| PubChem CID | 172793905 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | C[C@@H](N)c1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C9H13N3O/c1-6(10)7-3-2-4-8(5-7)9(11)12-13/h2-6,13H,10H2,1H3,(H2,11,12)/t6-/m1/s1 |
| InChIKey | PYBIKGRNVRRWEW-ZCFIWIBFSA-N |
| XLogP | 0.80 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide?
The IUPAC name of 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide (CID 172793905) is 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide.
What is the SMILES notation for 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide?
The canonical SMILES for 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide is C[C@@H](N)c1cccc(C(N)=NO)c1.
What is the InChIKey of 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide?
The InChIKey is PYBIKGRNVRRWEW-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H13N3O/c1-6(10)7-3-2-4-8(5-7)9(11)12-13/h2-6,13H,10H2,1H3,(H2,11,12)/t6-/m1/s1.
What are the key properties of 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide?
3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide has a molecular weight of 179.22 g/mol, XLogP of 0.80, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R)-1-aminoethyl]-N'-hydroxybenzenecarboximidamide is sourced from PubChem (CID 172793905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).