About (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate
(1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate (PubChem CID 172794118) has the molecular formula C26H32O2
and a molecular weight of 376.54 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate |
| PubChem CID | 172794118 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate |
| SMILES | CCC1(OC(=O)c2ccc(C3CC4CC3C3C5C=CC(C5)C43)cc2)CCCC1 |
| InChI | InChI=1S/C26H32O2/c1-2-26(11-3-4-12-26)28-25(27)17-7-5-16(6-8-17)21-14-20-15-22(21)24-19-10-9-18(13-19)23(20)24/h5-10,18-24H,2-4,11-15H2,1H3 |
| InChIKey | PYUGMAHVWQOIFL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate?
The IUPAC name of (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate (CID 172794118) is (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate.
What is the SMILES notation for (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate?
The canonical SMILES for (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate is CCC1(OC(=O)c2ccc(C3CC4CC3C3C5C=CC(C5)C43)cc2)CCCC1.
What is the InChIKey of (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate?
The InChIKey is PYUGMAHVWQOIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32O2/c1-2-26(11-3-4-12-26)28-25(27)17-7-5-16(6-8-17)21-14-20-15-22(21)24-19-10-9-18(13-19)23(20)24/h5-10,18-24H,2-4,11-15H2,1H3.
What are the key properties of (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate?
(1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate has a molecular weight of 376.54 g/mol, XLogP of 6.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 4-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)benzoate is sourced from PubChem (CID 172794118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).