acetic acid;dicyclohexyl(phenyl)phosphane

C22H35O4P — CID 172794555

IUPACacetic acid;dicyclohexyl(phenyl)phosphane
SMILESCC(=O)O.CC(=O)O.c1ccc(P(C2CCCCC2)C2CCCCC2)cc1
InChIInChI=1S/C18H27P.2C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2(3)4/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2;2*1H3,(H,3,4)
InChIKeyQAFSPWKCZZAVNE-UHFFFAOYSA-N
MW394.49 g/mol
LogP5.64
Rot. Bonds3

About acetic acid;dicyclohexyl(phenyl)phosphane

acetic acid;dicyclohexyl(phenyl)phosphane (PubChem CID 172794555) has the molecular formula C22H35O4P and a molecular weight of 394.49 g/mol. Its IUPAC name is acetic acid;dicyclohexyl(phenyl)phosphane.

Molecular Properties

Compound Nameacetic acid;dicyclohexyl(phenyl)phosphane
PubChem CID172794555
Molecular FormulaC22H35O4P
Molecular Weight394.49 g/mol
Exact Mass394.23
IUPAC Nameacetic acid;dicyclohexyl(phenyl)phosphane
SMILESCC(=O)O.CC(=O)O.c1ccc(P(C2CCCCC2)C2CCCCC2)cc1
InChIInChI=1S/C18H27P.2C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2(3)4/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2;2*1H3,(H,3,4)
InChIKeyQAFSPWKCZZAVNE-UHFFFAOYSA-N
XLogP5.64
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500394.49
LogP ≤ 55.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze acetic acid;dicyclohexyl(phenyl)phosphane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;dicyclohexyl(phenyl)phosphane?
The IUPAC name of acetic acid;dicyclohexyl(phenyl)phosphane (CID 172794555) is acetic acid;dicyclohexyl(phenyl)phosphane.
What is the SMILES notation for acetic acid;dicyclohexyl(phenyl)phosphane?
The canonical SMILES for acetic acid;dicyclohexyl(phenyl)phosphane is CC(=O)O.CC(=O)O.c1ccc(P(C2CCCCC2)C2CCCCC2)cc1.
What is the InChIKey of acetic acid;dicyclohexyl(phenyl)phosphane?
The InChIKey is QAFSPWKCZZAVNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27P.2C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2(3)4/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2;2*1H3,(H,3,4).
What are the key properties of acetic acid;dicyclohexyl(phenyl)phosphane?
acetic acid;dicyclohexyl(phenyl)phosphane has a molecular weight of 394.49 g/mol, XLogP of 5.64, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;dicyclohexyl(phenyl)phosphane is sourced from PubChem (CID 172794555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).