C22H35O4P — CID 172794555
acetic acid;dicyclohexyl(phenyl)phosphane (PubChem CID 172794555) has the molecular formula C22H35O4P and a molecular weight of 394.49 g/mol. Its IUPAC name is acetic acid;dicyclohexyl(phenyl)phosphane.
| Compound Name | acetic acid;dicyclohexyl(phenyl)phosphane |
|---|---|
| PubChem CID | 172794555 |
| Molecular Formula | C22H35O4P |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | acetic acid;dicyclohexyl(phenyl)phosphane |
| SMILES | CC(=O)O.CC(=O)O.c1ccc(P(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H27P.2C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2(3)4/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2;2*1H3,(H,3,4) |
| InChIKey | QAFSPWKCZZAVNE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|