C18H11ClN2O2S — CID 172794960
2-(4-chlorophenyl)-1,4-dioxido-3-thiophen-2-ylquinoxaline-1,4-diium (PubChem CID 172794960) has the molecular formula C18H11ClN2O2S and a molecular weight of 354.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,4-dioxido-3-thiophen-2-ylquinoxaline-1,4-diium.
| Compound Name | 2-(4-chlorophenyl)-1,4-dioxido-3-thiophen-2-ylquinoxaline-1,4-diium |
|---|---|
| PubChem CID | 172794960 |
| Molecular Formula | C18H11ClN2O2S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-(4-chlorophenyl)-1,4-dioxido-3-thiophen-2-ylquinoxaline-1,4-diium |
| SMILES | [O-][n+]1c(-c2ccc(Cl)cc2)c(-c2cccs2)[n+]([O-])c2ccccc21 |
| InChI | InChI=1S/C18H11ClN2O2S/c19-13-9-7-12(8-10-13)17-18(16-6-3-11-24-16)21(23)15-5-2-1-4-14(15)20(17)22/h1-11H |
| InChIKey | QBQGKVCCTLXPPU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|