About cyanocyanamide;trimethyl(trimethylsilyloxy)silane
cyanocyanamide;trimethyl(trimethylsilyloxy)silane (PubChem CID 172795747) has the molecular formula C8H19N3OSi2
and a molecular weight of 229.43 g/mol. Its IUPAC name is cyanocyanamide;trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | cyanocyanamide;trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 172795747 |
| Molecular Formula | C8H19N3OSi2 |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | cyanocyanamide;trimethyl(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C.N#CNC#N |
| InChI | InChI=1S/C6H18OSi2.C2HN3/c1-8(2,3)7-9(4,5)6;3-1-5-2-4/h1-6H3;5H |
| InChIKey | QEGIAHBTKCJPJB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyanocyanamide;trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanocyanamide;trimethyl(trimethylsilyloxy)silane?
The IUPAC name of cyanocyanamide;trimethyl(trimethylsilyloxy)silane (CID 172795747) is cyanocyanamide;trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for cyanocyanamide;trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for cyanocyanamide;trimethyl(trimethylsilyloxy)silane is C[Si](C)(C)O[Si](C)(C)C.N#CNC#N.
What is the InChIKey of cyanocyanamide;trimethyl(trimethylsilyloxy)silane?
The InChIKey is QEGIAHBTKCJPJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18OSi2.C2HN3/c1-8(2,3)7-9(4,5)6;3-1-5-2-4/h1-6H3;5H.
What are the key properties of cyanocyanamide;trimethyl(trimethylsilyloxy)silane?
cyanocyanamide;trimethyl(trimethylsilyloxy)silane has a molecular weight of 229.43 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanocyanamide;trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 172795747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).