C19H29NO3 — CID 172797361
[(2E)-10-(2-methylpropylamino)-10-oxodeca-2,4,8-trienyl] 3-methylbut-2-enoate (PubChem CID 172797361) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is [(2E)-10-(2-methylpropylamino)-10-oxodeca-2,4,8-trienyl] 3-methylbut-2-enoate.
| Compound Name | [(2E)-10-(2-methylpropylamino)-10-oxodeca-2,4,8-trienyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 172797361 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | [(2E)-10-(2-methylpropylamino)-10-oxodeca-2,4,8-trienyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OC/C=C/C=CCCC=CC(=O)NCC(C)C |
| InChI | InChI=1S/C19H29NO3/c1-16(2)14-19(22)23-13-11-9-7-5-6-8-10-12-18(21)20-15-17(3)4/h5,7,9-12,14,17H,6,8,13,15H2,1-4H3,(H,20,21)/b7-5?,11-9+,12-10? |
| InChIKey | QJVAMYODPOYLQT-KHZPVUEQSA-N |
| XLogP | 3.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|