C29H32BrF2N3OSi — CID 172797509
2-[[5-bromo-6-[2-(3,5-difluorophenyl)-1-(1,3-dihydroisoindol-2-yl)ethyl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 172797509) has the molecular formula C29H32BrF2N3OSi and a molecular weight of 584.58 g/mol. Its IUPAC name is 2-[[5-bromo-6-[2-(3,5-difluorophenyl)-1-(1,3-dihydroisoindol-2-yl)ethyl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-6-[2-(3,5-difluorophenyl)-1-(1,3-dihydroisoindol-2-yl)ethyl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 172797509 |
| Molecular Formula | C29H32BrF2N3OSi |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 2-[[5-bromo-6-[2-(3,5-difluorophenyl)-1-(1,3-dihydroisoindol-2-yl)ethyl]pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2cc(Br)c(C(Cc3cc(F)cc(F)c3)N3Cc4ccccc4C3)nc21 |
| InChI | InChI=1S/C29H32BrF2N3OSi/c1-37(2,3)11-10-36-19-34-9-8-21-15-26(30)28(33-29(21)34)27(14-20-12-24(31)16-25(32)13-20)35-17-22-6-4-5-7-23(22)18-35/h4-9,12-13,15-16,27H,10-11,14,17-19H2,1-3H3 |
| InChIKey | QKGZTBZAPDPSHN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|