C19H16ClF3N2O3S2 — CID 172798002
[(7S)-4'-chloro-3'-methyl-2-methylsulfanylspiro[6,8-dihydro-5H-quinazoline-7,1'-indene]-4-yl] trifluoromethanesulfonate (PubChem CID 172798002) has the molecular formula C19H16ClF3N2O3S2 and a molecular weight of 476.93 g/mol. Its IUPAC name is [(7S)-4'-chloro-3'-methyl-2-methylsulfanylspiro[6,8-dihydro-5H-quinazoline-7,1'-indene]-4-yl] trifluoromethanesulfonate.
| Compound Name | [(7S)-4'-chloro-3'-methyl-2-methylsulfanylspiro[6,8-dihydro-5H-quinazoline-7,1'-indene]-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172798002 |
| Molecular Formula | C19H16ClF3N2O3S2 |
| Molecular Weight | 476.93 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | [(7S)-4'-chloro-3'-methyl-2-methylsulfanylspiro[6,8-dihydro-5H-quinazoline-7,1'-indene]-4-yl] trifluoromethanesulfonate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CC[C@@]1(C=C(C)c3c(Cl)cccc31)C2 |
| InChI | InChI=1S/C19H16ClF3N2O3S2/c1-10-8-18(12-4-3-5-13(20)15(10)12)7-6-11-14(9-18)24-17(29-2)25-16(11)28-30(26,27)19(21,22)23/h3-5,8H,6-7,9H2,1-2H3/t18-/m1/s1 |
| InChIKey | QLXYSZFNVXPTPB-GOSISDBHSA-N |
| XLogP | 4.92 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|