C21H15F3O2 — CID 172799175
[cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;2,2,2-trifluoroacetate (PubChem CID 172799175) has the molecular formula C21H15F3O2 and a molecular weight of 356.34 g/mol. Its IUPAC name is [cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;2,2,2-trifluoroacetate.
| Compound Name | [cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 172799175 |
| Molecular Formula | C21H15F3O2 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [cyclohexa-2,4-dien-1-ylidene(phenyl)methyl]benzene;2,2,2-trifluoroacetate |
| SMILES | C1=C[CH+]C(=C(c2ccccc2)c2ccccc2)C=C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C19H15.C2HF3O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-2(4,5)1(6)7/h1-15H;(H,6,7)/q+1;/p-1 |
| InChIKey | QPVDYYDINVQSSC-UHFFFAOYSA-M |
| XLogP | 4.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|