C31H40Cl2N4O7S2Si — CID 172800538
N-[4-[4-[3,5-dichloro-4-(2-trimethylsilylethoxymethoxy)phenyl]piperazin-1-yl]sulfonylphenyl]-2-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 172800538) has the molecular formula C31H40Cl2N4O7S2Si and a molecular weight of 743.81 g/mol. Its IUPAC name is N-[4-[4-[3,5-dichloro-4-(2-trimethylsilylethoxymethoxy)phenyl]piperazin-1-yl]sulfonylphenyl]-2-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[4-[4-[3,5-dichloro-4-(2-trimethylsilylethoxymethoxy)phenyl]piperazin-1-yl]sulfonylphenyl]-2-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 172800538 |
| Molecular Formula | C31H40Cl2N4O7S2Si |
| Molecular Weight | 743.81 g/mol |
| Exact Mass | 742.15 |
| IUPAC Name | N-[4-[4-[3,5-dichloro-4-(2-trimethylsilylethoxymethoxy)phenyl]piperazin-1-yl]sulfonylphenyl]-2-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | CN(c1ccccc1C(=O)Nc1ccc(S(=O)(=O)N2CCN(c3cc(Cl)c(OCOCC[Si](C)(C)C)c(Cl)c3)CC2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C31H40Cl2N4O7S2Si/c1-35(45(2,39)40)29-9-7-6-8-26(29)31(38)34-23-10-12-25(13-11-23)46(41,42)37-16-14-36(15-17-37)24-20-27(32)30(28(33)21-24)44-22-43-18-19-47(3,4)5/h6-13,20-21H,14-19,22H2,1-5H3,(H,34,38) |
| InChIKey | QUKRRJUVBHAJPY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.81 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|