About styrene;trimethoxy(methyl)azanium;chloride
styrene;trimethoxy(methyl)azanium;chloride (PubChem CID 172801535) has the molecular formula C12H20ClNO3
and a molecular weight of 261.75 g/mol. Its IUPAC name is styrene;trimethoxy(methyl)azanium;chloride.
Molecular Properties
| Compound Name | styrene;trimethoxy(methyl)azanium;chloride |
| PubChem CID | 172801535 |
| Molecular Formula | C12H20ClNO3 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | styrene;trimethoxy(methyl)azanium;chloride |
| SMILES | C=Cc1ccccc1.CO[N+](C)(OC)OC.[Cl-] |
| InChI | InChI=1S/C8H8.C4H12NO3.ClH/c1-2-8-6-4-3-5-7-8;1-5(6-2,7-3)8-4;/h2-7H,1H2;1-4H3;1H/q;+1;/p-1 |
| InChIKey | QXXIKLSOLSPPBW-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze styrene;trimethoxy(methyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of styrene;trimethoxy(methyl)azanium;chloride?
The IUPAC name of styrene;trimethoxy(methyl)azanium;chloride (CID 172801535) is styrene;trimethoxy(methyl)azanium;chloride.
What is the SMILES notation for styrene;trimethoxy(methyl)azanium;chloride?
The canonical SMILES for styrene;trimethoxy(methyl)azanium;chloride is C=Cc1ccccc1.CO[N+](C)(OC)OC.[Cl-].
What is the InChIKey of styrene;trimethoxy(methyl)azanium;chloride?
The InChIKey is QXXIKLSOLSPPBW-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8.C4H12NO3.ClH/c1-2-8-6-4-3-5-7-8;1-5(6-2,7-3)8-4;/h2-7H,1H2;1-4H3;1H/q;+1;/p-1.
What are the key properties of styrene;trimethoxy(methyl)azanium;chloride?
styrene;trimethoxy(methyl)azanium;chloride has a molecular weight of 261.75 g/mol, XLogP of -0.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for styrene;trimethoxy(methyl)azanium;chloride is sourced from PubChem (CID 172801535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).