About 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol
2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol (PubChem CID 172802612) has the molecular formula C9H10ClNO2
and a molecular weight of 199.64 g/mol. Its IUPAC name is 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol |
| PubChem CID | 172802612 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol |
| SMILES | CC1(C)OC(O)c2ccc(Cl)nc21 |
| InChI | InChI=1S/C9H10ClNO2/c1-9(2)7-5(8(12)13-9)3-4-6(10)11-7/h3-4,8,12H,1-2H3 |
| InChIKey | RBMOGWZSSNNUFD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol?
The IUPAC name of 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol (CID 172802612) is 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol.
What is the SMILES notation for 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol?
The canonical SMILES for 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol is CC1(C)OC(O)c2ccc(Cl)nc21.
What is the InChIKey of 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol?
The InChIKey is RBMOGWZSSNNUFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2/c1-9(2)7-5(8(12)13-9)3-4-6(10)11-7/h3-4,8,12H,1-2H3.
What are the key properties of 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol?
2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol has a molecular weight of 199.64 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7,7-dimethyl-5H-furo[3,4-b]pyridin-5-ol is sourced from PubChem (CID 172802612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).