C18H18N2O12S4 — CID 172803052
1-[[9,10-dioxo-8-(1-sulfoethylsulfamoyl)anthracen-2-yl]sulfonylamino]ethanesulfonic acid (PubChem CID 172803052) has the molecular formula C18H18N2O12S4 and a molecular weight of 582.61 g/mol. Its IUPAC name is 1-[[9,10-dioxo-8-(1-sulfoethylsulfamoyl)anthracen-2-yl]sulfonylamino]ethanesulfonic acid.
| Compound Name | 1-[[9,10-dioxo-8-(1-sulfoethylsulfamoyl)anthracen-2-yl]sulfonylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 172803052 |
| Molecular Formula | C18H18N2O12S4 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 581.97 |
| IUPAC Name | 1-[[9,10-dioxo-8-(1-sulfoethylsulfamoyl)anthracen-2-yl]sulfonylamino]ethanesulfonic acid |
| SMILES | CC(NS(=O)(=O)c1ccc2c(c1)C(=O)c1c(cccc1S(=O)(=O)NC(C)S(=O)(=O)O)C2=O)S(=O)(=O)O |
| InChI | InChI=1S/C18H18N2O12S4/c1-9(35(27,28)29)19-33(23,24)11-6-7-12-14(8-11)18(22)16-13(17(12)21)4-3-5-15(16)34(25,26)20-10(2)36(30,31)32/h3-10,19-20H,1-2H3,(H,27,28,29)(H,30,31,32) |
| InChIKey | RDBWJXLVNFCYNL-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 235.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|