C8HCl5O3 — CID 172803944
4,5,6,7-tetrachloro-2-benzofuran-1,3-dione;hydrochloride (PubChem CID 172803944) has the molecular formula C8HCl5O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-benzofuran-1,3-dione;hydrochloride.
| Compound Name | 4,5,6,7-tetrachloro-2-benzofuran-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 172803944 |
| Molecular Formula | C8HCl5O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 319.84 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-benzofuran-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1OC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c21 |
| InChI | InChI=1S/C8Cl4O3.ClH/c9-3-1-2(8(14)15-7(1)13)4(10)6(12)5(3)11;/h;1H |
| InChIKey | ISGRWGXGIMSAKI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|