C39H55N3O2 — CID 172804134
(4R)-4-(3,3-dibutylcyclohexa-1,5-dien-1-yl)-2-[6-[(4R)-4-(3,3-dibutylcyclohexa-1,5-dien-1-yl)-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole (PubChem CID 172804134) has the molecular formula C39H55N3O2 and a molecular weight of 597.89 g/mol. Its IUPAC name is (4R)-4-(3,3-dibutylcyclohexa-1,5-dien-1-yl)-2-[6-[(4R)-4-(3,3-dibutylcyclohexa-1,5-dien-1-yl)-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-(3,3-dibutylcyclohexa-1,5-dien-1-yl)-2-[6-[(4R)-4-(3,3-dibutylcyclohexa-1,5-dien-1-yl)-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 172804134 |
| Molecular Formula | C39H55N3O2 |
| Molecular Weight | 597.89 g/mol |
| Exact Mass | 597.43 |
| IUPAC Name | (4R)-4-(3,3-dibutylcyclohexa-1,5-dien-1-yl)-2-[6-[(4R)-4-(3,3-dibutylcyclohexa-1,5-dien-1-yl)-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCC1(CCCC)C=C([C@@H]2COC(c3cccc(C4=N[C@H](C5=CC(CCCC)(CCCC)CC=C5)CO4)n3)=N2)C=CC1 |
| InChI | InChI=1S/C39H55N3O2/c1-5-9-20-38(21-10-6-2)24-14-16-30(26-38)34-28-43-36(41-34)32-18-13-19-33(40-32)37-42-35(29-44-37)31-17-15-25-39(27-31,22-11-7-3)23-12-8-4/h13-19,26-27,34-35H,5-12,20-25,28-29H2,1-4H3/t34-,35-/m0/s1 |
| InChIKey | RGRFEMFALXWYTJ-PXLJZGITSA-N |
| XLogP | 9.88 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.89 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |