C14H18F6N6O4 — CID 172804982
2-(5-piperazin-1-yl-2-pyridinyl)guanidine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 172804982) has the molecular formula C14H18F6N6O4 and a molecular weight of 448.32 g/mol. Its IUPAC name is 2-(5-piperazin-1-yl-2-pyridinyl)guanidine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(5-piperazin-1-yl-2-pyridinyl)guanidine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 172804982 |
| Molecular Formula | C14H18F6N6O4 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-(5-piperazin-1-yl-2-pyridinyl)guanidine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC(N)=Nc1ccc(N2CCNCC2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H16N6.2C2HF3O2/c11-10(12)15-9-2-1-8(7-14-9)16-5-3-13-4-6-16;2*3-2(4,5)1(6)7/h1-2,7,13H,3-6H2,(H4,11,12,14,15);2*(H,6,7) |
| InChIKey | RJSDHAKGUPVVGD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 167.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|