sulfuric acid diazide

H2N6O4S-2 — CID 172805549

IUPACsulfuric acid diazide
SMILESO=S(=O)(O)O.[N-]=[N+]=[N-].[N-]=[N+]=[N-]
InChIInChI=1S/2N3.H2O4S/c2*1-3-2;1-5(2,3)4/h;;(H2,1,2,3,4)/q2*-1;
InChIKeyRLNPMMZDOVEXFF-UHFFFAOYSA-N
MW182.12 g/mol
LogP1.08
Rot. Bonds

About sulfuric acid diazide

sulfuric acid diazide (PubChem CID 172805549) has the molecular formula H2N6O4S-2 and a molecular weight of 182.12 g/mol. Its IUPAC name is sulfuric acid diazide.

Molecular Properties

Compound Namesulfuric acid diazide
PubChem CID172805549
Molecular FormulaH2N6O4S-2
Molecular Weight182.12 g/mol
Exact Mass181.99
IUPAC Namesulfuric acid diazide
SMILESO=S(=O)(O)O.[N-]=[N+]=[N-].[N-]=[N+]=[N-]
InChIInChI=1S/2N3.H2O4S/c2*1-3-2;1-5(2,3)4/h;;(H2,1,2,3,4)/q2*-1;
InChIKeyRLNPMMZDOVEXFF-UHFFFAOYSA-N
XLogP1.08
TPSA192.00 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.12
LogP ≤ 51.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sulfuric acid diazide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfuric acid diazide?
The IUPAC name of sulfuric acid diazide (CID 172805549) is sulfuric acid diazide.
What is the SMILES notation for sulfuric acid diazide?
The canonical SMILES for sulfuric acid diazide is O=S(=O)(O)O.[N-]=[N+]=[N-].[N-]=[N+]=[N-].
What is the InChIKey of sulfuric acid diazide?
The InChIKey is RLNPMMZDOVEXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/2N3.H2O4S/c2*1-3-2;1-5(2,3)4/h;;(H2,1,2,3,4)/q2*-1;.
What are the key properties of sulfuric acid diazide?
sulfuric acid diazide has a molecular weight of 182.12 g/mol, XLogP of 1.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid diazide is sourced from PubChem (CID 172805549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).