C17H16N2O7 — CID 172807080
5-O-ethyl 3-O-methyl 2-methyl-1-(4-nitrophenyl)-6-oxopyridine-3,5-dicarboxylate (PubChem CID 172807080) has the molecular formula C17H16N2O7 and a molecular weight of 360.32 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 2-methyl-1-(4-nitrophenyl)-6-oxopyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 2-methyl-1-(4-nitrophenyl)-6-oxopyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 172807080 |
| Molecular Formula | C17H16N2O7 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2-methyl-1-(4-nitrophenyl)-6-oxopyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OC)c(C)n(-c2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C17H16N2O7/c1-4-26-17(22)14-9-13(16(21)25-3)10(2)18(15(14)20)11-5-7-12(8-6-11)19(23)24/h5-9H,4H2,1-3H3 |
| InChIKey | RQTJPVNEFPJMBF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 117.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|