C19H23FN3+ — CID 172807326
10-(2-(18F)fluoroethyl)-3-N,3-N,6-N,6-N-tetramethylacridin-10-ium-3,6-diamine (PubChem CID 172807326) has the molecular formula C19H23FN3+ and a molecular weight of 311.41 g/mol. Its IUPAC name is 10-(2-(18F)fluoroethyl)-3-N,3-N,6-N,6-N-tetramethylacridin-10-ium-3,6-diamine.
| Compound Name | 10-(2-(18F)fluoroethyl)-3-N,3-N,6-N,6-N-tetramethylacridin-10-ium-3,6-diamine |
|---|---|
| PubChem CID | 172807326 |
| Molecular Formula | C19H23FN3+ |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 10-(2-(18F)fluoroethyl)-3-N,3-N,6-N,6-N-tetramethylacridin-10-ium-3,6-diamine |
| SMILES | CN(C)c1ccc2cc3ccc(N(C)C)cc3[n+](CC[18F])c2c1 |
| InChI | InChI=1S/C19H23FN3/c1-21(2)16-7-5-14-11-15-6-8-17(22(3)4)13-19(15)23(10-9-20)18(14)12-16/h5-8,11-13H,9-10H2,1-4H3/q+1/i20-1 |
| InChIKey | RRPSPTMNZVAKMD-LRFGSCOBSA-N |
| XLogP | 3.38 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|