C28H32O6S — CID 172807686
2,2-dideuterio-3-[4-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 172807686) has the molecular formula C28H32O6S and a molecular weight of 498.64 g/mol. Its IUPAC name is 2,2-dideuterio-3-[4-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 2,2-dideuterio-3-[4-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 172807686 |
| Molecular Formula | C28H32O6S |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 2,2-dideuterio-3-[4-[[3-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | [2H]C([2H])(Cc1ccc(OCc2cccc(-c3c(C)cc(OCCCS(C)(=O)=O)cc3C)c2)cc1)C(=O)O |
| InChI | InChI=1S/C28H32O6S/c1-20-16-26(33-14-5-15-35(3,31)32)17-21(2)28(20)24-7-4-6-23(18-24)19-34-25-11-8-22(9-12-25)10-13-27(29)30/h4,6-9,11-12,16-18H,5,10,13-15,19H2,1-3H3,(H,29,30)/i13D2 |
| InChIKey | RSXJQNUGUUZVQR-KLTYLHELSA-N |
| XLogP | 5.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|