C31H70N2O6Si2 — CID 172807810
N,N'-bis[4-(2,2-diethoxyethoxysilyl)octyl]propane-1,3-diamine (PubChem CID 172807810) has the molecular formula C31H70N2O6Si2 and a molecular weight of 623.08 g/mol. Its IUPAC name is N,N'-bis[4-(2,2-diethoxyethoxysilyl)octyl]propane-1,3-diamine.
| Compound Name | N,N'-bis[4-(2,2-diethoxyethoxysilyl)octyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 172807810 |
| Molecular Formula | C31H70N2O6Si2 |
| Molecular Weight | 623.08 g/mol |
| Exact Mass | 622.48 |
| IUPAC Name | N,N'-bis[4-(2,2-diethoxyethoxysilyl)octyl]propane-1,3-diamine |
| SMILES | CCCCC(CCCNCCCNCCCC(CCCC)[SiH2]OCC(OCC)OCC)[SiH2]OCC(OCC)OCC |
| InChI | InChI=1S/C31H70N2O6Si2/c1-7-13-18-28(40-38-26-30(34-9-3)35-10-4)20-15-22-32-24-17-25-33-23-16-21-29(19-14-8-2)41-39-27-31(36-11-5)37-12-6/h28-33H,7-27,40-41H2,1-6H3 |
| InChIKey | RTGGWDMIEQHPHC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.08 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|