C7H15N2O2S+ — CID 172808399
[[(2-methylpropan-2-yl)oxycarbonylamino]-methylsulfanylmethylidene]azanium (PubChem CID 172808399) has the molecular formula C7H15N2O2S+ and a molecular weight of 191.28 g/mol. Its IUPAC name is [[(2-methylpropan-2-yl)oxycarbonylamino]-methylsulfanylmethylidene]azanium.
| Compound Name | [[(2-methylpropan-2-yl)oxycarbonylamino]-methylsulfanylmethylidene]azanium |
|---|---|
| PubChem CID | 172808399 |
| Molecular Formula | C7H15N2O2S+ |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | [[(2-methylpropan-2-yl)oxycarbonylamino]-methylsulfanylmethylidene]azanium |
| SMILES | CSC(=[NH2+])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H14N2O2S/c1-7(2,3)11-6(10)9-5(8)12-4/h1-4H3,(H2,8,9,10)/p+1 |
| InChIKey | QNNVPHNPWRBCKH-UHFFFAOYSA-O |
| XLogP | -0.01 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|