C20H36N2O5 — CID 172808685
(2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy 2,2,6,6-tetramethylpiperidine-4-carboperoxoate (PubChem CID 172808685) has the molecular formula C20H36N2O5 and a molecular weight of 384.52 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy 2,2,6,6-tetramethylpiperidine-4-carboperoxoate.
| Compound Name | (2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy 2,2,6,6-tetramethylpiperidine-4-carboperoxoate |
|---|---|
| PubChem CID | 172808685 |
| Molecular Formula | C20H36N2O5 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidine-4-carbonyl)oxy 2,2,6,6-tetramethylpiperidine-4-carboperoxoate |
| SMILES | CC1(C)CC(C(=O)OOOC(=O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C20H36N2O5/c1-17(2)9-13(10-18(3,4)21-17)15(23)25-27-26-16(24)14-11-19(5,6)22-20(7,8)12-14/h13-14,21-22H,9-12H2,1-8H3 |
| InChIKey | RWDZGFSHHDIZSI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|