C64H50F4N4O8 — CID 172809110
[2-[10,15,20-tris[2-(4-fluoropent-3-enoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 4-fluoropent-3-enoate (PubChem CID 172809110) has the molecular formula C64H50F4N4O8 and a molecular weight of 1079.12 g/mol. Its IUPAC name is [2-[10,15,20-tris[2-(4-fluoropent-3-enoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 4-fluoropent-3-enoate.
| Compound Name | [2-[10,15,20-tris[2-(4-fluoropent-3-enoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 4-fluoropent-3-enoate |
|---|---|
| PubChem CID | 172809110 |
| Molecular Formula | C64H50F4N4O8 |
| Molecular Weight | 1079.12 g/mol |
| Exact Mass | 1078.36 |
| IUPAC Name | [2-[10,15,20-tris[2-(4-fluoropent-3-enoyloxy)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl] 4-fluoropent-3-enoate |
| SMILES | CC(F)=CCC(=O)Oc1ccccc1-c1c2nc(c(-c3ccccc3OC(=O)CC=C(C)F)c3ccc([nH]3)c(-c3ccccc3OC(=O)CC=C(C)F)c3nc(c(-c4ccccc4OC(=O)CC=C(C)F)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C64H50F4N4O8/c1-37(65)21-33-57(73)77-53-17-9-5-13-41(53)61-45-25-27-47(69-45)62(42-14-6-10-18-54(42)78-58(74)34-22-38(2)66)49-29-31-51(71-49)64(44-16-8-12-20-56(44)80-60(76)36-24-40(4)68)52-32-30-50(72-52)63(48-28-26-46(61)70-48)43-15-7-11-19-55(43)79-59(75)35-23-39(3)67/h5-32,69,72H,33-36H2,1-4H3/b37-21?,38-22?,39-23?,40-24?,61-45-,61-46-,62-47-,62-49-,63-48-,63-50-,64-51-,64-52- |
| InChIKey | RXPBAGIAJFGCPP-BDRDHAJZSA-N |
| XLogP | 16.00 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.12 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|