About 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one
4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one (PubChem CID 172811618) has the molecular formula C24H38O4
and a molecular weight of 390.56 g/mol. Its IUPAC name is 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one |
| PubChem CID | 172811618 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one |
| SMILES | C=COCC1(C=C)OC(=O)OC1(CCC1CCCCC1)CCC1CCCCC1 |
| InChI | InChI=1S/C24H38O4/c1-3-23(19-26-4-2)24(28-22(25)27-23,17-15-20-11-7-5-8-12-20)18-16-21-13-9-6-10-14-21/h3-4,20-21H,1-2,5-19H2 |
| InChIKey | SGEMTWTXFBNFSX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one?
The IUPAC name of 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one (CID 172811618) is 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one.
What is the SMILES notation for 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one?
The canonical SMILES for 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one is C=COCC1(C=C)OC(=O)OC1(CCC1CCCCC1)CCC1CCCCC1.
What is the InChIKey of 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one?
The InChIKey is SGEMTWTXFBNFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H38O4/c1-3-23(19-26-4-2)24(28-22(25)27-23,17-15-20-11-7-5-8-12-20)18-16-21-13-9-6-10-14-21/h3-4,20-21H,1-2,5-19H2.
What are the key properties of 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one?
4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one has a molecular weight of 390.56 g/mol, XLogP of 6.70, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(2-cyclohexylethyl)-5-(ethenoxymethyl)-5-ethenyl-1,3-dioxolan-2-one is sourced from PubChem (CID 172811618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).