About 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine
5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine (PubChem CID 172811906) has the molecular formula C20H24ClN3O
and a molecular weight of 357.88 g/mol. Its IUPAC name is 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine.
Molecular Properties
| Compound Name | 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine |
| PubChem CID | 172811906 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine |
| SMILES | Clc1cnc(N2CCC(C[C@H]3C[C@@H]3COc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C20H24ClN3O/c21-18-12-22-20(23-13-18)24-8-6-15(7-9-24)10-16-11-17(16)14-25-19-4-2-1-3-5-19/h1-5,12-13,15-17H,6-11,14H2/t16-,17+/m0/s1 |
| InChIKey | SHDUMAGFHKCIOU-DLBZAZTESA-N |
| XLogP | 4.45 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine?
The IUPAC name of 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine (CID 172811906) is 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine.
What is the SMILES notation for 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine?
The canonical SMILES for 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine is Clc1cnc(N2CCC(C[C@H]3C[C@@H]3COc3ccccc3)CC2)nc1.
What is the InChIKey of 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine?
The InChIKey is SHDUMAGFHKCIOU-DLBZAZTESA-N. The full InChI is InChI=1S/C20H24ClN3O/c21-18-12-22-20(23-13-18)24-8-6-15(7-9-24)10-16-11-17(16)14-25-19-4-2-1-3-5-19/h1-5,12-13,15-17H,6-11,14H2/t16-,17+/m0/s1.
What are the key properties of 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine?
5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine has a molecular weight of 357.88 g/mol, XLogP of 4.45, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[4-[[(1S,2S)-2-(phenoxymethyl)cyclopropyl]methyl]piperidin-1-yl]pyrimidine is sourced from PubChem (CID 172811906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).