C9H2F14O2 — CID 172812854
[1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-yl] 3,3-dideuterio-2-fluoroprop-2-enoate (PubChem CID 172812854) has the molecular formula C9H2F14O2 and a molecular weight of 410.10 g/mol. Its IUPAC name is [1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-yl] 3,3-dideuterio-2-fluoroprop-2-enoate.
| Compound Name | [1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-yl] 3,3-dideuterio-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 172812854 |
| Molecular Formula | C9H2F14O2 |
| Molecular Weight | 410.10 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | [1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-yl] 3,3-dideuterio-2-fluoroprop-2-enoate |
| SMILES | [2H]C([2H])=C(F)C(=O)OC(C(F)(F)F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H2F14O2/c1-2(10)3(24)25-5(8(18,19)20,9(21,22)23)4(11,6(12,13)14)7(15,16)17/h1H2/i1D2 |
| InChIKey | SKNAIZBQNWXTML-DICFDUPASA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.10 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|