C12H6Cl5NaO — CID 172813188
sodium;1,2,3,4,5-pentachlorobenzene-6-ide;phenol (PubChem CID 172813188) has the molecular formula C12H6Cl5NaO and a molecular weight of 366.43 g/mol. Its IUPAC name is sodium;1,2,3,4,5-pentachlorobenzene-6-ide;phenol.
| Compound Name | sodium;1,2,3,4,5-pentachlorobenzene-6-ide;phenol |
|---|---|
| PubChem CID | 172813188 |
| Molecular Formula | C12H6Cl5NaO |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 363.88 |
| IUPAC Name | sodium;1,2,3,4,5-pentachlorobenzene-6-ide;phenol |
| SMILES | Clc1[c-]c(Cl)c(Cl)c(Cl)c1Cl.Oc1ccccc1.[Na+] |
| InChI | InChI=1S/C6Cl5.C6H6O.Na/c7-2-1-3(8)5(10)6(11)4(2)9;7-6-4-2-1-3-5-6;/h;1-5,7H;/q-1;;+1 |
| InChIKey | DBCATEOJVQXABI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|