About tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane
tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane (PubChem CID 172813476) has the molecular formula C24H46N2OSSiSn
and a molecular weight of 557.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane |
| PubChem CID | 172813476 |
| Molecular Formula | C24H46N2OSSiSn |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1sc2c(O[Si](C)(C)C(C)(C)C)ncn2c1C |
| InChI | InChI=1S/C12H19N2OSSi.3C4H9.Sn/c1-9-7-16-11-10(13-8-14(9)11)15-17(5,6)12(2,3)4;3*1-3-4-2;/h8H,1-6H3;3*1,3-4H2,2H3; |
| InChIKey | SMRCNNJQQSDKSD-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane?
The IUPAC name of tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane (CID 172813476) is tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane.
What is the SMILES notation for tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane?
The canonical SMILES for tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane is CCCC[Sn](CCCC)(CCCC)c1sc2c(O[Si](C)(C)C(C)(C)C)ncn2c1C.
What is the InChIKey of tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane?
The InChIKey is SMRCNNJQQSDKSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N2OSSi.3C4H9.Sn/c1-9-7-16-11-10(13-8-14(9)11)15-17(5,6)12(2,3)4;3*1-3-4-2;/h8H,1-6H3;3*1,3-4H2,2H3;.
What are the key properties of tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane?
tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane has a molecular weight of 557.51 g/mol, XLogP of 8.14, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-(3-methyl-2-tributylstannylimidazo[5,1-b][1,3]thiazol-7-yl)oxysilane is sourced from PubChem (CID 172813476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).