About 2,5-ditert-butyl-1,2-benzodiazepine
2,5-ditert-butyl-1,2-benzodiazepine (PubChem CID 172813665) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 2,5-ditert-butyl-1,2-benzodiazepine.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-1,2-benzodiazepine |
| PubChem CID | 172813665 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2,5-ditert-butyl-1,2-benzodiazepine |
| SMILES | CC(C)(C)C1=c2ccccc2=NN(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C17H24N2/c1-16(2,3)14-11-12-19(17(4,5)6)18-15-10-8-7-9-13(14)15/h7-12H,1-6H3 |
| InChIKey | SNHCKQUPSSBKKB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-ditert-butyl-1,2-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-1,2-benzodiazepine?
The IUPAC name of 2,5-ditert-butyl-1,2-benzodiazepine (CID 172813665) is 2,5-ditert-butyl-1,2-benzodiazepine.
What is the SMILES notation for 2,5-ditert-butyl-1,2-benzodiazepine?
The canonical SMILES for 2,5-ditert-butyl-1,2-benzodiazepine is CC(C)(C)C1=c2ccccc2=NN(C(C)(C)C)C=C1.
What is the InChIKey of 2,5-ditert-butyl-1,2-benzodiazepine?
The InChIKey is SNHCKQUPSSBKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2/c1-16(2,3)14-11-12-19(17(4,5)6)18-15-10-8-7-9-13(14)15/h7-12H,1-6H3.
What are the key properties of 2,5-ditert-butyl-1,2-benzodiazepine?
2,5-ditert-butyl-1,2-benzodiazepine has a molecular weight of 256.39 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-1,2-benzodiazepine is sourced from PubChem (CID 172813665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).