C9H8F3N3O5S — CID 172814914
2-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid (PubChem CID 172814914) has the molecular formula C9H8F3N3O5S and a molecular weight of 327.24 g/mol. Its IUPAC name is 2-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid.
| Compound Name | 2-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid |
|---|---|
| PubChem CID | 172814914 |
| Molecular Formula | C9H8F3N3O5S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylic acid |
| SMILES | O=C(O)N1CCc2cnc(OS(=O)(=O)C(F)(F)F)nc2C1 |
| InChI | InChI=1S/C9H8F3N3O5S/c10-9(11,12)21(18,19)20-7-13-3-5-1-2-15(8(16)17)4-6(5)14-7/h3H,1-2,4H2,(H,16,17) |
| InChIKey | SRIWVZWTACKBPU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|