About CID 172815273
CID 172815273 (PubChem CID 172815273) has the molecular formula C16H13FLiN2O6
and a molecular weight of 355.23 g/mol.
Molecular Properties
| Compound Name | CID 172815273 |
| PubChem CID | 172815273 |
| Molecular Formula | C16H13FLiN2O6 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | — |
| SMILES | COC(=O)c1cc(OCc2c(-c3ccc(F)cc3)noc2CO)no1.[Li] |
| InChI | InChI=1S/C16H13FN2O6.Li/c1-22-16(21)12-6-14(18-24-12)23-8-11-13(7-20)25-19-15(11)9-2-4-10(17)5-3-9;/h2-6,20H,7-8H2,1H3; |
| InChIKey | SSNOUFRAJVSJLS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 172815273 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172815273?
The IUPAC name of CID 172815273 (CID 172815273) is not available.
What is the SMILES notation for CID 172815273?
The canonical SMILES for CID 172815273 is COC(=O)c1cc(OCc2c(-c3ccc(F)cc3)noc2CO)no1.[Li].
What is the InChIKey of CID 172815273?
The InChIKey is SSNOUFRAJVSJLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O6.Li/c1-22-16(21)12-6-14(18-24-12)23-8-11-13(7-20)25-19-15(11)9-2-4-10(17)5-3-9;/h2-6,20H,7-8H2,1H3;.
What are the key properties of CID 172815273?
CID 172815273 has a molecular weight of 355.23 g/mol, XLogP of 1.95, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172815273 is sourced from PubChem (CID 172815273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).