C16H13FLiN2O6 — CID 172815273
CID 172815273 (PubChem CID 172815273) has the molecular formula C16H13FLiN2O6 and a molecular weight of 355.23 g/mol.
| Compound Name | CID 172815273 |
|---|---|
| PubChem CID | 172815273 |
| Molecular Formula | C16H13FLiN2O6 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | — |
| SMILES | COC(=O)c1cc(OCc2c(-c3ccc(F)cc3)noc2CO)no1.[Li] |
| InChI | InChI=1S/C16H13FN2O6.Li/c1-22-16(21)12-6-14(18-24-12)23-8-11-13(7-20)25-19-15(11)9-2-4-10(17)5-3-9;/h2-6,20H,7-8H2,1H3; |
| InChIKey | SSNOUFRAJVSJLS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |