C13H14N4O3 — CID 172817559
5,8-dioxo-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6,11-triene-4-carboxamide (PubChem CID 172817559) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5,8-dioxo-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6,11-triene-4-carboxamide.
| Compound Name | 5,8-dioxo-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 172817559 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5,8-dioxo-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6,11-triene-4-carboxamide |
| SMILES | NC(=O)c1cn2c(cc1=O)C(=O)N1CC=CCCN2C1 |
| InChI | InChI=1S/C13H14N4O3/c14-12(19)9-7-17-10(6-11(9)18)13(20)15-4-2-1-3-5-16(17)8-15/h1-2,6-7H,3-5,8H2,(H2,14,19) |
| InChIKey | SZZDYKCYXHORDJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|