C32H19B4F20NO12 — CID 172817578
N,N-dimethylaniline;tetrakis((2,3,4,5,6-pentafluorophenoxy)boronic acid) (PubChem CID 172817578) has the molecular formula C32H19B4F20NO12 and a molecular weight of 1032.71 g/mol. Its IUPAC name is N,N-dimethylaniline;tetrakis((2,3,4,5,6-pentafluorophenoxy)boronic acid).
| Compound Name | N,N-dimethylaniline;tetrakis((2,3,4,5,6-pentafluorophenoxy)boronic acid) |
|---|---|
| PubChem CID | 172817578 |
| Molecular Formula | C32H19B4F20NO12 |
| Molecular Weight | 1032.71 g/mol |
| Exact Mass | 1033.10 |
| IUPAC Name | N,N-dimethylaniline;tetrakis((2,3,4,5,6-pentafluorophenoxy)boronic acid) |
| SMILES | CN(C)c1ccccc1.OB(O)Oc1c(F)c(F)c(F)c(F)c1F.OB(O)Oc1c(F)c(F)c(F)c(F)c1F.OB(O)Oc1c(F)c(F)c(F)c(F)c1F.OB(O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H11N.4C6H2BF5O3/c1-9(2)8-6-4-3-5-7-8;4*8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h3-7H,1-2H3;4*13-14H |
| InChIKey | TTXCDTZZAOYACC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 202.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|